![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 02 Fluke ATOM BOMB.mp3 | 2015-10-17 13:05 | 11M | |
| 10 Daft Punk MUSIQUE.mp3 | 2015-10-17 13:07 | 9.4M | |
| 01 The Future Sound of London WE HAVE EXPLOSIVE.mp3 | 2015-10-17 13:05 | 8.6M | |
| 12 Photek TITAN.mp3 | 2015-10-17 13:07 | 8.2M | |
| 13 Orbital PETROL.mp3 | 2015-10-17 13:07 | 8.0M | |
| 07 The Future Sound of London WE HAVE EXPLOSIVE (Hero Killing).mp3 | 2015-10-17 13:06 | 7.8M | |
| 11 Source Direct 2097.mp3 | 2015-10-17 13:07 | 7.7M | |
| 09 Fluke V SIX.mp3 | 2015-10-17 13:06 | 7.3M | |
| 06 The Chemical Brothers LEAVE HOME (Underworld Mix1).mp3 | 2015-10-17 13:06 | 7.2M | |
| 04 Underworld THIN THERE.mp3 | 2015-10-17 13:05 | 6.9M | |
| 05 Photek THE THIRD SEQUENCE.mp3 | 2015-10-17 13:06 | 6.6M | |
| 03 The Chemical Brothers LOOPS OF FURY.mp3 | 2015-10-17 13:05 | 6.5M | |
| 08 Prodigy FIRESTARTER [Instrumental].mp3 | 2015-10-17 13:06 | 6.4M | |
| 14 Leftfield AFRO RIDE.mp3 | 2015-10-17 13:07 | 6.1M | |